![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
.gif){kind=link}
.gif){kind=link}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 061545_NailPolishGla..> | 20-Apr-2010 03:25 | 41K | |
| 061546_NailPolishGla..> | 20-Apr-2010 03:24 | 38K | |
| 061548_NailPolishGla..> | 20-Apr-2010 03:21 | 40K | |
| 061549_NailPolishGla..> | 20-Apr-2010 03:23 | 41K | |
| 061554_MascaraSilver..> | 20-Apr-2010 03:55 | 25K | |
| 061555_MascaraBlackG..> | 20-Apr-2010 03:51 | 24K | |
| 061556_MascaraFuchsi..> | 20-Apr-2010 03:53 | 27K | |
| 061557_MascaraElectr..> | 20-Apr-2010 03:53 | 26K | |
| 061568_MascaraPurple..> | 20-Apr-2010 03:54 | 28K | |
| 061663_BYSMineralsNa..> | 07-Mar-2009 01:47 | 84K | |
| 062172_NailPolishCol..> | 01-Jun-2011 02:17 | 105K | |
| 1.jpg | 02-Aug-2010 22:10 | 26K | |
| 1_bg.gif | 11-Jun-2008 01:26 | 173 | |
| 1_bg1.gif | 11-Jun-2008 01:26 | 199 | |
| 1_li.gif | 11-Jun-2008 01:26 | 58 | |
| 1_q1.gif | 11-Jun-2008 01:26 | 294 | |
| 1_q2.gif | 11-Jun-2008 01:26 | 277 | |
| 1_q3.gif | 11-Jun-2008 01:26 | 118 | |
| 1_q4.gif | 11-Jun-2008 01:26 | 117 | |
| 2.jpg | 02-Aug-2010 22:08 | 23K | |
| 3.jpg | 02-Aug-2010 22:06 | 24K | |
| 5TH AVENUE 75ML EDP ..> | 22-Apr-2010 11:14 | 23K | |
| 5th Avenue eau de pa..> | 22-Apr-2010 10:53 | 28K | |
| 5th Avenue eau de pa..> | 22-Apr-2010 10:51 | 33K | |
| 5th Avenue edp Spray..> | 21-Jun-2008 03:45 | 1.6K | |
| 5th avenue edp spray..> | 21-Jun-2008 03:48 | 1.6K | |
| 5th avenue edp spray..> | 21-Jun-2008 03:55 | 1.9K | |
| 60bk.jpg | 22-May-2008 16:32 | 9.2K | |
| 100.jpg | 04-Mar-2009 05:25 | 71K | |
| 110.jpg | 14-Jul-2009 03:27 | 25K | |
| 120.jpg | 14-Jul-2009 03:28 | 25K | |
| 140.jpg | 14-Jul-2009 03:32 | 26K | |
| 185 PLUMBERRY......jpg | 27-Feb-2009 03:44 | 45K | |
| 200.jpg | 04-Mar-2009 04:56 | 66K | |
| 210.jpg | 14-Jul-2009 03:31 | 25K | |
| 217...jpg | 27-Feb-2009 03:43 | 55K | |
| 219 PREMIERE PLUM.....> | 27-Feb-2009 03:38 | 61K | |
| 220.jpg | 14-Jul-2009 03:33 | 26K | |
| 245 SUBTLE AMBER......> | 27-Feb-2009 03:36 | 121K | |
| 310.jpg | 14-Jul-2009 03:35 | 26K | |
| 317.jpg | 19-Jan-2009 01:14 | 51K | |
| 321.jpg | 19-Jan-2009 01:10 | 46K | |
| 330.jpg | 14-Jul-2009 03:36 | 26K | |
| 400.jpg | 04-Mar-2009 05:14 | 91K | |
| 410.jpg | 14-Jul-2009 03:37 | 28K | |
| 500.jpg | 04-Mar-2009 05:22 | 72K | |
| 510.jpg | 04-Mar-2009 05:18 | 65K | |
| 520.jpg | 04-Mar-2009 05:10 | 81K | |
| 705 Pink Petals.jpg | 07-Jun-2011 23:48 | 32K | |
| 712.jpg | 06-Jun-2011 00:22 | 30K | |
| 715 Precious Metals.jpg | 07-Jun-2011 23:49 | 33K | |
| 725 Va Va Va Bloom.jpg | 07-Jun-2011 23:47 | 32K | |
| 740 SeaShells.jpg | 07-Jun-2011 23:51 | 30K | |
| 750 Twilight.jpg | 07-Jun-2011 23:51 | 32K | |
| 755 Khaki Suede.jpg | 07-Jun-2011 23:50 | 26K | |
| 800.jpg | 04-Mar-2009 05:31 | 62K | |
| 810.jpg | 04-Mar-2009 05:30 | 69K | |
| 3238.jpg | 22-May-2008 16:28 | 7.3K | |
| 3241.jpg | 22-May-2008 16:28 | 7.0K | |
| 3247.jpg | 22-May-2008 16:28 | 10K | |
| 3592.jpg | 22-May-2008 16:28 | 16K | |
| 3904.jpg | 22-May-2008 16:28 | 17K | |
| 5895_d.jpg | 22-May-2008 16:31 | 85K | |
| 13226.jpg | 22-May-2008 16:28 | 7.8K | |
| 41601.jpg | 22-May-2008 16:28 | 7.8K | |
| 41602.jpg | 22-May-2008 16:28 | 22K | |
| 60101S.jpg | 22-May-2008 16:31 | 5.4K | |
| AFTER FIVE.jpg | 06-Jan-2009 01:00 | 32K | |
| ANGLE.jpg | 06-Jan-2009 01:11 | 39K | |
| AP827.jpg | 22-May-2008 16:34 | 914 | |
| ARMANI CODE EDP 50ML..> | 27-Apr-2010 02:42 | 30K | |
| Age Perfect Day Cre..> | 22-Apr-2010 04:15 | 26K | |
| Age Perfect Day Cre..> | 22-Apr-2010 04:17 | 25K | |
| Age Perfect Night Cr..> | 22-Apr-2010 04:28 | 26K | |
| Age Perfect Night Cr..> | 22-Apr-2010 04:26 | 27K | |
| Age Reperfect Day Cr..> | 22-Apr-2010 04:34 | 26K | |
| Age Reperfect Night ..> | 22-Apr-2010 04:37 | 21K | |
| Almay Daily Moisturi..> | 21-Apr-2010 04:34 | 21K | |
| Almond Blonde.jpg | 12-Jul-2008 22:38 | 12K | |
| Anais Anais edt spra..> | 22-Jun-2008 04:04 | 3.0K | |
| Angel edp spray 25ml..> | 22-Jun-2008 03:40 | 2.2K | |
| Arden Beauty edp spr..> | 22-Apr-2010 11:18 | 29K | |
| Arden Set copy.jpg | 27-Sep-2008 00:22 | 827K | |
| Armani Mania edp spr..> | 22-Jun-2008 01:18 | 1.4K | |
| Arpage edp spray 100..> | 22-Jun-2008 02:59 | 1.8K | |
| Arpege edp spray 100..> | 22-Apr-2010 11:22 | 25K | |
| Arpege edp spray 100..> | 22-Jun-2008 03:14 | 1.8K | |
| Australis.jpg | 23-May-2008 22:15 | 4.5K | |
| Australis Brush on F..> | 12-Jul-2008 04:42 | 8.2K | |
| BLV edp spray 75ml.jpg | 22-Jun-2008 00:50 | 3.0K | |
| BRITNEY SPEARS CURIO..> | 06-Jan-2009 00:18 | 243K | |
| BRITNEY SPEARS MIDNI..> | 06-Jan-2009 00:21 | 43K | |
| BVLGARI POUR FEMME ..> | 27-Apr-2010 01:53 | 25K | |
| BYS.gif | 23-May-2008 22:16 | 2.6K | |
| BYS Bronzed Blushed ..> | 09-Nov-2008 08:48 | 843K | |
| BYS Creme Foundation..> | 01-Jun-2011 01:58 | 60K | |
| BYS Creme Foundation..> | 01-Jun-2011 01:59 | 60K | |
| BYS Creme Foundation..> | 01-Jun-2011 02:00 | 60K | |
| BYS Flawless Coverag..> | 09-Nov-2008 06:02 | 897K | |
| BYS Liquid Foundati..> | 01-Jun-2011 02:14 | 85K | |
| BYS Liquid Foundati..> | 01-Jun-2011 02:15 | 87K | |
| BYS Liquid Foundati..> | 01-Jun-2011 01:56 | 87K | |
| BYS Liquid Foundati..> | 01-Jun-2011 01:56 | 88K | |
| BYS Liquid Foundati..> | 01-Jun-2011 01:57 | 85K | |
| BYS Liquid test.jpg | 01-Jun-2011 02:25 | 20K | |
| BYS Minerals Natural..> | 01-Jun-2011 02:10 | 148K | |
| BYS Minerals Natural..> | 01-Jun-2011 02:01 | 120K | |
| BYS Minerals Natural..> | 01-Jun-2011 02:02 | 115K | |
| BYS Minerals Natural..> | 01-Jun-2011 02:03 | 120K | |
| BYS Minerals Natural..> | 01-Jun-2011 02:04 | 118K | |
| BYS Minerals Natural..> | 01-Jun-2011 02:11 | 147K | |
| BYS Minerals Natural..> | 01-Jun-2011 02:12 | 149K | |
| BYS Nail Colour Lila..> | 20-Jul-2008 00:51 | 2.3K | |
| BYS Nail Colour Mint..> | 20-Jul-2008 00:50 | 2.2K | |
| BYS Nail Coulour Cor..> | 20-Jul-2008 00:49 | 2.6K | |
| BYS Nail Enamel Aqua..> | 20-Apr-2010 03:38 | 23K | |
| BYS Nail Enamel Astr..> | 20-Apr-2010 03:40 | 24K | |
| BYS Nail Enamel Blac..> | 20-Apr-2010 03:03 | 21K | |
| BYS Nail Enamel Cora..> | 20-Apr-2010 03:07 | 25K | |
| BYS Nail Enamel Flas..> | 20-Apr-2010 03:41 | 24K | |
| BYS Nail Enamel Flir..> | 20-Apr-2010 03:42 | 24K | |
| BYS Nail Enamel Fuch..> | 20-Apr-2010 03:44 | 24K | |
| BYS Nail Enamel Pink..> | 20-Apr-2010 03:45 | 23K | |
| BYS Nail Enamel Rebe..> | 20-Apr-2010 03:47 | 24K | |
| BYS Nail Enamel Suns..> | 20-Apr-2010 02:51 | 24K | |
| BYS Nail Enamel Top ..> | 20-Apr-2010 03:48 | 22K | |
| BYS Nail POilsh Suns..> | 20-Jul-2008 00:52 | 2.3K | |
| BYS Nail Polish Blac..> | 20-Jul-2008 00:53 | 2.0K | |
| BYS Nail Polish Col..> | 01-Jun-2011 02:06 | 100K | |
| BYS Nail Polish Col..> | 01-Jun-2011 02:07 | 105K | |
| BYS Nail Polish Col..> | 01-Jun-2011 02:35 | 27K | |
| BYS Nail Polish Col..> | 01-Jun-2011 02:08 | 111K | |
| BYS Nail Polish Colo..> | 01-Jun-2011 02:10 | 115K | |
| BYS Nail Polish Col..> | 01-Jun-2011 02:09 | 111K | |
| BYS Natural Delight ..> | 09-Nov-2008 05:56 | 98K | |
| Baby Doll Make up ki..> | 09-Nov-2008 08:44 | 896K | |
| Baby Doll edp spray ..> | 22-Apr-2010 11:24 | 29K | |
| BakedEyeshadowWithAp..> | 30-Aug-2008 06:56 | 9.2K | |
| Baked eye shadow Aqu..> | 30-Aug-2008 06:46 | 9.2K | |
| Baked eye shadow Bla..> | 30-Aug-2008 06:47 | 9.2K | |
| Baked eye shadow Bro..> | 30-Aug-2008 06:48 | 9.2K | |
| Baked eye shadow eme..> | 30-Aug-2008 06:49 | 9.2K | |
| Baked eye shadow gol..> | 30-Aug-2008 06:50 | 9.5K | |
| Baked eye shadow mid..> | 30-Aug-2008 06:51 | 9.3K | |
| Baked eyeshadow shee..> | 30-Aug-2008 06:52 | 9.4K | |
| Beautiful edp spray ..> | 22-Jun-2008 03:08 | 2.5K | |
| Beckham signature ed..> | 18-May-2010 02:42 | 31K | |
| Bed Head After-Party..> | 22-Apr-2010 10:44 | 24K | |
| Bed Head Control Fre..> | 22-Apr-2010 10:40 | 25K | |
| Bed Head Control Fre..> | 25-Jun-2008 04:00 | 1.4K | |
| Bed Head Control Fre..> | 25-Jun-2008 03:58 | 1.6K | |
| Bed Head Dumb Blonde..> | 25-Jun-2008 03:33 | 1.6K | |
| Bed Head Dumb Blonde..> | 25-Jun-2008 03:39 | 1.6K | |
| Bed Head MANIPULATOR..> | 25-Jun-2008 03:44 | 3.5K | |
| Bed Head MANIPULATOR..> | 22-Apr-2010 10:46 | 26K | |
| Bed Head MANIPULATOR..> | 25-Jun-2008 03:48 | 1.8K | |
| Bed Head MANIPULATOR..> | 25-Jun-2008 03:51 | 1.0K | |
| Bed Head MASTERMIND ..> | 25-Jun-2008 03:41 | 2.7K | |
| Bed Head Moisture Ma..> | 25-Jun-2008 04:04 | 1.1K | |
| Bed Head Moisture Ma..> | 25-Jun-2008 04:02 | 1.2K | |
| Billabong2.jpg | 19-May-2008 21:30 | 4.4K | |
| Billabong Body Butte..> | 09-Aug-2008 04:15 | 48K | |
| Billabong Body Butte..> | 09-Aug-2008 04:19 | 41K | |
| Billabong body wash ..> | 09-Aug-2008 04:36 | 34K | |
| Billabong edt spray ..> | 22-Jun-2008 22:27 | 1.6K | |
| Blockbuster.png | 27-Sep-2008 00:43 | 554K | |
| Body Kouros edt Spra..> | 22-Jun-2008 05:22 | 2.5K | |
| Body Tonic.jpg | 25-Jul-2008 00:34 | 1.5K | |
| Boss Elements edt sp..> | 22-Jun-2008 22:49 | 1.5K | |
| Bright Pruple.jpg | 01-Jun-2011 02:36 | 27K | |
| Bvlagri pour homme.jpg | 22-Jun-2008 05:12 | 1.8K | |
| Bvlagri pour homme e..> | 22-Jun-2008 05:20 | 2.7K | |
| Bvlgari BLV edp Spra..> | 27-Apr-2010 02:27 | 31K | |
| Bys Minerals Natural..> | 06-Sep-2009 02:36 | 149K | |
| Byzance edt spray 10..> | 22-Jun-2008 02:15 | 1.9K | |
| CHRISTINA AGUILERA E..> | 22-Apr-2010 11:26 | 37K | |
| Charcol.jpeg | 07-Jun-2011 23:17 | 31K | |
| Christina Aguilera e..> | 22-Jun-2008 03:48 | 2.0K | |
| Chrome Azzaro edt sp..> | 22-Jun-2008 06:20 | 2.5K | |
| Chrome Azzaro edt sp..> | 22-Jun-2008 06:18 | 2.5K | |
| Chrtistina Aguilera.jpg | 25-Jul-2008 00:27 | 1.7K | |
| Ciara edt spray 68ml..> | 22-Apr-2010 11:28 | 36K | |
| Clinique Happy edp s..> | 22-Jun-2008 01:56 | 1.1K | |
| Colorstay Revlon San..> | 10-Aug-2009 10:51 | 19K | |
| Cool Water Woman edt..> | 22-Jun-2008 01:46 | 1.6K | |
| Coolwater Deep edt s..> | 22-Jun-2008 22:21 | 2.5K | |
| Coolwater edt spray ..> | 22-Jun-2008 23:02 | 2.7K | |
| Coolwater edt spray ..> | 22-Jun-2008 23:03 | 2.3K | |
| Cosmetics.jpg | 09-Jun-2008 04:10 | 3.5K | |
| CoverGirl.jpg | 23-May-2008 22:15 | 30K | |
| Cover Girl Aqua 1.jpg | 20-Apr-2010 04:18 | 27K | |
| Cover Girl Aqua 2.jpg | 20-Apr-2010 04:19 | 26K | |
| Cover Girl Fresh Co..> | 28-Jun-2008 02:01 | 2.2K | |
| Cover Girl Lipstick ..> | 20-Apr-2010 04:33 | 28K | |
| Cover Girl Lipstick ..> | 20-Apr-2010 04:33 | 28K | |
| Cover Girl Outlast S..> | 20-Apr-2010 05:01 | 25K | |
| Cover Girl Pocket Po..> | 20-Apr-2010 04:44 | 36K | |
| Covergirl Aquasmooth..> | 01-Jul-2009 04:08 | 2.1K | |
| Covergirl Outlast Li..> | 26-Jul-2008 03:42 | 6.5K | |
| Covergirl Outlast li..> | 26-Jul-2008 03:34 | 1.7K | |
| Covergirl Outlast sm..> | 26-Jul-2008 03:16 | 2.8K | |
| Cover girl Pocket Po..> | 19-Sep-2008 04:50 | 3.5K | |
| Covergirl outlast Li..> | 26-Jul-2008 03:44 | 2.1K | |
| Creamy Natural Light..> | 06-Jun-2011 01:35 | 25K | |
| Curious edp spray 50..> | 22-Jun-2008 01:35 | 2.6K | |
| Curious edp spray 10..> | 22-Apr-2010 11:30 | 33K | |
| DSCF0905.png | 12-Jul-2008 03:36 | 535K | |
| DSC_0548.jpg | 12-Oct-2009 09:05 | 89K | |
| DSC_0550.jpg | 12-Oct-2009 08:59 | 57K | |
| DSC_0552.jpg | 12-Oct-2009 09:07 | 61K | |
| Dark Blue edt spray ..> | 22-Jun-2008 22:29 | 2.0K | |
| David Beckham Instin..> | 22-Jun-2008 22:53 | 2.9K | |
| Deep Red edt spray 9..> | 22-Jun-2008 03:58 | 2.5K | |
| Define - A - Lash Ve..> | 21-Apr-2010 02:12 | 29K | |
| Define a lash.jpg | 15-Nov-2008 02:31 | 1.8K | |
| Derma Genesis Day Cr..> | 15-Nov-2008 02:45 | 1.4K | |
| Derma Genesis Night ..> | 15-Nov-2008 02:49 | 6.9K | |
| Diesel Femmine edt s..> | 22-Apr-2010 11:34 | 24K | |
| Diesel Zero Plus edt..> | 22-Jun-2008 22:25 | 1.7K | |
| Dolce & Gabbana Orig..> | 22-Jun-2008 00:38 | 2.0K | |
| Dolce & Gabbana edt ..> | 22-Jun-2008 22:18 | 2.4K | |
| Dolece & Gabbana The..> | 22-Jun-2008 00:46 | 1.6K | |
| Dunhill Desire Blue ..> | 22-Jun-2008 06:22 | 2.6K | |
| Elizabeth Arden Cera..> | 13-Aug-2009 00:02 | 2.5K | |
| Elizabeth Arden Cera..> | 26-Sep-2009 02:27 | 2.2K | |
| Elizabeth Arden Flaw..> | 28-Jun-2008 02:23 | 1.6K | |
| Elizabeth Arden Flaw..> | 20-Apr-2010 05:11 | 27K | |
| Elizabeth Arden cera..> | 20-Apr-2010 05:08 | 27K | |
| Elizabeth Arden cera..> | 20-Apr-2010 05:09 | 30K | |
| Elizabth Arden 5th A..> | 06-Jan-2009 00:46 | 42K | |
| Escada Sentiment edt..> | 22-Jun-2008 06:16 | 2.6K | |
| Eternity edp 100ml.jpg | 27-Apr-2010 02:33 | 27K | |
| Expert Wear Fade Pro..> | 21-Apr-2010 02:00 | 29K | |
| Expert Wear Fade Pro..> | 21-Apr-2010 01:50 | 29K | |
| Eyeshadow 5 Piece Ho..> | 31-May-2011 22:52 | 234K | |
| Eyeshadow 5 Piece Ho..> | 31-May-2011 22:54 | 187K | |
| Eyeshadow 5 Piece Ho..> | 31-May-2011 22:56 | 195K | |
| Eyeshadow 5 Piece Ho..> | 31-May-2011 22:57 | 233K | |
| Eyeshadow 8 Pallet D..> | 31-May-2011 22:58 | 120K | |
| Eyeshadow 8 Pallet M..> | 31-May-2011 23:00 | 115K | |
| Eyeshadow 8 Pallet M..> | 31-May-2011 23:01 | 87K | |
| Eyeshadow 8 Pallet M..> | 31-May-2011 23:02 | 103K | |
| Eyeshadow Animal Ins..> | 31-May-2011 23:03 | 109K | |
| Eyeshadow Animal Ins..> | 31-May-2011 23:05 | 113K | |
| EyeshadowAnimal Inst..> | 31-May-2011 23:07 | 120K | |
| Eyeshadow Animal Ins..> | 31-May-2011 23:06 | 115K | |
| Facial Steaming Syst..> | 22-Apr-2010 10:32 | 21K | |
| Fantastic Lash Masca..> | 20-Apr-2010 04:58 | 26K | |
| Fendi edt spray 100m..> | 22-Jun-2008 02:36 | 3.2K | |
| Fire & Ice edt spray..> | 22-Apr-2010 11:44 | 30K | |
| Fire & Ice edt spray..> | 22-Jun-2008 04:44 | 2.0K | |
| Fujiyama edt spray 1..> | 13-Aug-2008 03:41 | 4.8K | |
| GIORGIO BEVERLY HILL..> | 22-Apr-2010 11:47 | 32K | |
| Garnier Ambre Sloair..> | 14-Jul-2008 05:02 | 1.6K | |
| Garnier Bidy Tonic S..> | 14-Jul-2008 09:27 | 1.5K | |
| Garnier Clean & Soft..> | 19-Jul-2008 00:54 | 1.5K | |
| Garnier Clean & Soft..> | 21-Apr-2010 04:39 | 29K | |
| Garnier Clean & soft..> | 28-Jun-2008 03:21 | 1.0K | |
| Garnier No streaks B..> | 14-Jul-2008 05:00 | 1.7K | |
| Garnier Nutritionist..> | 21-Apr-2010 04:46 | 32K | |
| Garnier Nutritionist..> | 19-Jul-2008 00:41 | 2.7K | |
| Garnier Nutritionist..> | 21-Apr-2010 04:48 | 28K | |
| Garnier Nutritionist..> | 21-Apr-2010 04:46 | 25K | |
| Garnier Re-density n..> | 19-Jul-2008 00:37 | 2.0K | |
| Garnier Skin Natural..> | 28-Jun-2008 03:23 | 1.1K | |
| Garnier Tanning Kit.jpg | 14-Jul-2008 09:17 | 2.6K | |
| Garnier UV.jpg | 15-Apr-2010 02:20 | 70K | |
| Garnier Ultra Lift P..> | 21-Apr-2010 04:54 | 29K | |
| Garnier Ultra Lift e..> | 19-Jul-2008 00:30 | 2.4K | |
| Garnier Ultra lift .jpg | 21-Apr-2010 04:52 | 27K | |
| Garnier Ultra lift p..> | 15-Apr-2010 02:21 | 135K | |
| Garnier eye roll on.jpg | 15-Apr-2010 02:18 | 143K | |
| Garnier re-density d..> | 19-Jul-2008 00:34 | 2.0K | |
| Garnier ultral lift ..> | 19-Jul-2008 00:28 | 2.9K | |
| Gifts.jpg | 23-May-2008 22:07 | 23K | |
| Giorgio Beverly Hill..> | 22-Jun-2008 02:31 | 1.9K | |
| Giorgio Beverly Hill..> | 22-Jun-2008 02:28 | 1.9K | |
| Giorgio Red edt spra..> | 22-Jun-2008 02:34 | 2.4K | |
| Givenchy eau De Parf..> | 23-Apr-2010 00:06 | 23K | |
| Glam Glitter Kinky P..> | 20-Apr-2010 03:20 | 40K | |
| Glitter Purple.jpg | 01-Jun-2011 02:37 | 28K | |
| Glow After Dark edt ..> | 22-Jun-2008 02:43 | 3.2K | |
| Glow By JLO edt spra..> | 22-Jun-2008 02:45 | 2.0K | |
| Green Tea eau de par..> | 22-Apr-2010 11:49 | 22K | |
| Green edt spray 75ml..> | 22-Jun-2008 04:11 | 1.1K | |
| Green tea edp spray ..> | 21-Jun-2008 03:41 | 2.0K | |
| Gucci edp spray 30ml..> | 22-Jun-2008 03:04 | 1.4K | |
| Haircare.jpg | 23-May-2008 22:10 | 14K | |
| Heiress edp spray 50..> | 22-Apr-2010 11:52 | 33K | |
| Heiress edp spray 50..> | 22-Jun-2008 02:00 | 1.3K | |
| Honey Beige Medium 4..> | 06-Jun-2011 01:31 | 25K | |
| Hugo Boss Number One..> | 22-Jun-2008 22:36 | 2.4K | |
| Hugo Boss Woman edt ..> | 22-Apr-2010 11:54 | 28K | |
| Hugo Boss edt spray ..> | 22-Jun-2008 22:34 | 2.4K | |
| Hugo Boss edt spray ..> | 22-Jun-2008 22:31 | 2.8K | |
| Hugo Boss edt spray ..> | 22-Jun-2008 22:33 | 2.1K | |
| Hummer 2 edt spray 1..> | 22-Jun-2008 22:42 | 1.2K | |
| Hummer edt spray 125..> | 22-Jun-2008 22:40 | 1.6K | |
| Incontrol Curious ed..> | 22-Apr-2010 11:56 | 32K | |
| Intimately Beckham e..> | 22-Apr-2010 11:58 | 26K | |
| Intimately Beckham e..> | 22-Jun-2008 03:20 | 1.8K | |
| Island Bronze Face &..> | 30-Aug-2008 06:35 | 5.4K | |
| Island Bronze Make u..> | 30-Aug-2008 06:39 | 7.0K | |
| Island Bronze Spray ..> | 30-Aug-2008 06:34 | 2.3K | |
| Island Bronze Tannin..> | 30-Aug-2008 06:37 | 2.9K | |
| Island Brozne Make U..> | 20-Apr-2010 04:02 | 34K | |
| Issey Miyake edt spr..> | 22-Apr-2010 12:01 | 26K | |
| Issey Miyake edt spr..> | 22-Jun-2008 01:30 | 1.1K | |
| Issey Miyake edt spr..> | 22-Jun-2008 23:09 | 1.6K | |
| Issey Miyake edt spr..> | 22-Jun-2008 23:08 | 1.3K | |
| Jazz edt spray 100ml..> | 22-Jun-2008 22:57 | 2.9K | |
| Jean Paul Gaultier e..> | 22-Jun-2008 02:12 | 2.7K | |
| Jean Paul Gaultier e..> | 22-Jun-2008 22:45 | 2.7K | |
| Joop edt spray 125ml..> | 22-Jun-2008 22:38 | 3.0K | |
| Joop femme.jpg | 27-Apr-2010 02:06 | 31K | |
| Just Me edp spray 50..> | 22-Jun-2008 02:02 | 1.7K | |
| Just Me edp spray100..> | 22-Apr-2010 12:03 | 33K | |
| Kohl Minerals 01 Pre..> | 20-Apr-2010 10:16 | 24K | |
| Kohl Minerals 03 Met..> | 20-Apr-2010 10:17 | 26K | |
| Kohl Minerals 05 Ice..> | 20-Apr-2010 10:16 | 25K | |
| L.air du temps edt s..> | 22-Jun-2008 04:06 | 1.8K | |
| L\'oreal Age Perfect..> | 06-Jun-2011 00:21 | 30K | |
| L\'oreal Age Perfect..> | 06-Jun-2011 00:21 | 35K | |
| Lagerfeild Classic e..> | 22-Jun-2008 06:14 | 2.3K | |
| Light Blue edt spray..> | 22-Jun-2008 00:42 | 2.0K | |
| Limited Edition Levo..> | 02-Aug-2008 00:32 | 549K | |
| Live Jazz edt spray ..> | 22-Jun-2008 05:25 | 3.4K | |
| Live edp spray 100 m..> | 22-Jun-2008 02:39 | 2.5K | |
| Lolita Lempicka edp ..> | 22-Jun-2008 03:37 | 2.0K | |
| Loreal.jpg | 23-May-2008 22:14 | 10K | |
| Loreal Age Perfect 7..> | 06-Jun-2011 00:44 | 31K | |
| Loreal Age Perfect 7..> | 06-Jun-2011 01:05 | 36K | |
| Loreal Age Perfect 7..> | 06-Jun-2011 01:09 | 33K | |
| Loreal Age Perfect 7..> | 06-Jun-2011 01:07 | 35K | |
| Loreal Age Perfect W..> | 01-May-2010 06:55 | 1.6K | |
| Loreal Age re perfec..> | 22-Apr-2010 04:32 | 24K | |
| Loreal Age re perfec..> | 22-Apr-2010 04:31 | 24K | |
| Loreal Age re perfec..> | 20-Apr-2010 05:14 | 36K | |
| Loreal Bare Natural ..> | 04-Sep-2009 04:18 | 2.2K | |
| Loreal Cashmere Perf..> | 20-Apr-2010 05:27 | 31K | |
| Loreal Colour Appeal..> | 20-Apr-2010 05:40 | 32K | |
| Loreal Colour Appeal..> | 20-Apr-2010 05:40 | 32K | |
| Loreal Colour Appeal..> | 20-Apr-2010 05:39 | 31K | |
| Loreal Derma Genesis..> | 22-Apr-2010 04:40 | 24K | |
| Loreal Derma Genesis..> | 22-Apr-2010 04:42 | 25K | |
| Loreal Glycolic peel..> | 28-Jun-2008 03:13 | 1.6K | |
| Loreal Infalliable l..> | 20-Apr-2010 05:49 | 25K | |
| Loreal Infallible Co..> | 20-Apr-2010 05:53 | 26K | |
| Loreal Infallible Co..> | 15-Nov-2008 03:03 | 1.6K | |
| Loreal Infallible Ma..> | 20-Apr-2010 05:57 | 29K | |
| Loreal Infallible Ma..> | 15-Nov-2008 02:58 | 1.9K | |
| Loreal Lash Architec..> | 28-Apr-2010 00:35 | 25K | |
| Loreal Men Expert Er..> | 22-Apr-2010 04:43 | 28K | |
| Loreal Mineral Kohl.jpg | 24-Apr-2009 06:04 | 1.3K | |
| Loreal Mineral Kohl ..> | 24-Apr-2009 06:02 | 18K | |
| Loreal Mineral eye s..> | 20-Apr-2010 05:18 | 27K | |
| Loreal Mineral eye s..> | 20-Apr-2010 05:20 | 33K | |
| Loreal Pencil Perfec..> | 20-Apr-2010 10:31 | 22K | |
| Loreal Revitalift Da..> | 27-May-2009 01:20 | 1.6K | |
| Loreal Touch-On Colo..> | 20-Apr-2010 10:56 | 29K | |
| Loreal Touch ON Colo..> | 02-Aug-2008 00:59 | 3.0K | |
| Loreal Visbile lift ..> | 16-Apr-2009 06:01 | 1.3K | |
| Loreal Visible Lift ..> | 20-Apr-2010 11:08 | 23K | |
| Loreal Visibly Clean..> | 12-Oct-2008 02:52 | 2.2K | |
| Loreal Wear Infinte ..> | 09-Aug-2008 03:55 | 14K | |
| Loreal Wear infinte ..> | 18-Jul-2008 05:05 | 2.3K | |
| Loreal wear infinte ..> | 09-Aug-2008 03:53 | 13K | |
| Loreal wear infinte ..> | 09-Aug-2008 03:54 | 13K | |
| Love AT First Glow e..> | 22-Jun-2008 02:42 | 2.1K | |
| Lovely edp spray 30m..> | 22-Jun-2008 02:55 | 1.0K | |
| Lovely edp spray 100..> | 22-Apr-2010 12:05 | 27K | |
| Lrl Colour Appeal Mi..> | 09-Aug-2008 02:20 | 28K | |
| Lrl colour appeal Bi..> | 09-Aug-2008 02:16 | 28K | |
| Lrl colour appeal Fo..> | 09-Aug-2008 02:18 | 30K | |
| Lrl colur appeal cho..> | 09-Aug-2008 02:21 | 32K | |
| MF FP.jpg | 01-Jul-2009 04:21 | 1.5K | |
| Makeup.jpg | 23-May-2008 22:07 | 47K | |
| Mariah Carey edp spr..> | 22-Apr-2010 23:48 | 28K | |
| Mariah Carey edt spr..> | 22-Jun-2008 01:24 | 1.7K | |
| Maroussia edt spray ..> | 22-Apr-2010 23:50 | 28K | |
| Mascara Electric Blu..> | 30-Aug-2008 06:42 | 8.5K | |
| Mascara Fuchsia Glitter | 30-Aug-2008 06:43 | 8.5K | |
| Mascara Purple Glitter | 30-Aug-2008 06:43 | 10K | |
| Mascara Silver Glitter | 30-Aug-2008 06:44 | 7.8K | |
| Max Factor Color Gen..> | 21-Apr-2010 01:28 | 25K | |
| Max Factor Color Gen..> | 21-Apr-2010 01:29 | 25K | |
| Max Factor Color Gen..> | 21-Apr-2010 01:30 | 27K | |
| Max Factor Color Gen..> | 21-Apr-2010 01:31 | 26K | |
| Max Factor Color Gen..> | 21-Apr-2010 01:32 | 26K | |
| Max Factor Color Gen..> | 21-Apr-2010 01:33 | 25K | |
| Max Factor Color Gen..> | 21-Apr-2010 01:34 | 27K | |
| Max Factor Color Gen..> | 21-Apr-2010 01:35 | 27K | |
| MaxFactor Panstick -..> | 20-Apr-2010 11:45 | 25K | |
| MaxFactor Satin Blus..> | 20-Apr-2010 11:48 | 25K | |
| MaxFactor Silk Perfe..> | 20-Apr-2010 11:53 | 30K | |
| Max Factor WHIPPED C..> | 20-Apr-2010 11:25 | 25K | |
| Max Factor WHIPPED C..> | 20-Apr-2010 11:26 | 23K | |
| Maxfactor 2000 calor..> | 18-Jul-2008 03:58 | 2.1K | |
| Maxfactor Erace Cove..> | 20-Apr-2010 11:30 | 19K | |
| Maxfactor Erace Cove..> | 18-Jul-2008 04:45 | 1.3K | |
| Maxfactor Flawless p..> | 20-Apr-2010 11:39 | 23K | |
| Maxfactor Lash Lift ..> | 20-Apr-2010 11:42 | 23K | |
| Maxfactor Lashlift M..> | 10-Aug-2009 11:08 | 1.7K | |
| Maxfactor Pancake Ma..> | 18-Jul-2008 04:14 | 1.5K | |
| Maxfactor Pancake ma..> | 20-Apr-2010 11:51 | 23K | |
| Maxfactor Panstick F..> | 18-Jul-2008 04:55 | 1.3K | |
| Maxfactor Silk perfe..> | 18-Jul-2008 04:37 | 1.6K | |
| Maxfactor Silk perfe..> | 18-Jul-2008 04:36 | 3.2K | |
| Maxfactor eyelash cu..> | 20-Apr-2010 11:19 | 20K | |
| Maybeeline Mineral P..> | 27-May-2009 01:14 | 2.4K | |
| Maybelline.jpg | 23-May-2008 22:14 | 2.5K | |
| Maybelline 3 in1 | 21-Apr-2010 02:07 | 24K | |
| Maybelline 3in1 .jpg | 21-Apr-2010 01:59 | 30K | |
| Maybelline 3 in1 ex..> | 21-Apr-2010 01:57 | 24K | |
| Maybelline 3 in1 ex..> | 21-Apr-2010 01:58 | 17K | |
| Maybelline Cover Sti..> | 28-Apr-2010 00:42 | 30K | |
| Maybelline Diamond s..> | 02-Aug-2008 00:44 | 1.2K | |
| Maybelline Dream Mat..> | 25-Jun-2008 03:28 | 1.9K | |
| Maybelline Dream Mat..> | 21-Apr-2010 01:41 | 29K | |
| Maybelline Great Las..> | 07-Sep-2009 05:51 | 29K | |
| Maybelline Instant R..> | 06-Jun-2011 01:30 | 25K | |
| Maybelline Lash disc..> | 19-Sep-2008 03:11 | 2.2K | |
| Maybelline Mascara B..> | 21-Apr-2010 02:16 | 35K | |
| Maybelline Mineral C..> | 27-May-2009 00:51 | 2.0K | |
| Maybelline Mineral P..> | 21-Apr-2010 02:19 | 30K | |
| Maybelline Mineral P..> | 21-Apr-2010 02:21 | 30K | |
| Maybelline Mineral P..> | 21-Apr-2010 02:25 | 31K | |
| Maybelline Mineral P..> | 27-May-2009 01:10 | 3.0K | |
| Maybelline Mineral P..> | 21-Apr-2010 02:31 | 25K | |
| Maybelline Mineral P..> | 06-Jun-2011 03:05 | 24K | |
| Maybelline Moisture ..> | 27-Jul-2008 01:45 | 4.6K | |
| Maybelline Moisture ..> | 27-Jul-2008 01:59 | 5.5K | |
| Maybelline Moisture ..> | 27-Jul-2008 01:47 | 4.6K | |
| Maybelline Moisture ..> | 27-Jul-2008 01:52 | 4.5K | |
| Maybelline Moisture ..> | 27-Jul-2008 01:49 | 4.5K | |
| Maybelline SHINE SED..> | 21-Apr-2010 02:38 | 24K | |
| Maybelline Stiletto ..> | 21-Apr-2010 02:40 | 28K | |
| Maybelline SuperStay..> | 21-Apr-2010 02:46 | 22K | |
| Maybelline Wonder Fi..> | 21-Apr-2010 02:50 | 28K | |
| Maybelline Wonder fi..> | 12-Oct-2008 02:29 | 1.6K | |
| Maybelline dream mat..> | 17-Jun-2008 09:40 | 2.0K | |
| Maybelline expert we..> | 17-Jun-2008 09:46 | 3.0K | |
| Maybelline expert we..> | 23-Aug-2008 01:36 | 1.3K | |
| Maybelline expert we..> | 23-Aug-2008 01:38 | 1.9K | |
| Maybelline express s..> | 16-Aug-2008 05:29 | 2.2K | |
| Maybelline siletto m..> | 07-Sep-2009 06:33 | 913K | |
| Maybelline superstay..> | 26-Feb-2009 04:53 | 1.6K | |
| Mediterranean edp Sp..> | 22-Apr-2010 23:52 | 24K | |
| Mediterranean edt sp..> | 22-Jun-2008 01:02 | 2.4K | |
| Men expert erase wri..> | 15-Nov-2008 03:15 | 2.2K | |
| Mens Fragrance.jpg | 23-May-2008 22:08 | 29K | |
| Midnight Fantasy edp..> | 22-Jun-2008 01:38 | 2.8K | |
| Midnight Fantasyedp ..> | 22-Apr-2010 23:55 | 31K | |
| Mineral eye shadow G..> | 19-Sep-2008 04:06 | 1.1K | |
| Mineral eye shadow V..> | 19-Sep-2008 04:07 | 817 | |
| Mineral eye shadow b..> | 19-Sep-2008 04:03 | 816 | |
| Mineral eye shadow s..> | 19-Sep-2008 04:09 | 1.1K | |
| Miracle edp spray 10..> | 22-Jun-2008 01:27 | 1.4K | |
| Moschino edt spray 3..> | 22-Jun-2008 01:43 | 1.6K | |
| NYX Eyebrow Cake Pow..> | 06-Jun-2011 02:16 | 26K | |
| NYX Eyebrow Cake Pow..> | 06-Jun-2011 02:15 | 26K | |
| NYX Eyebrow Cake Pow..> | 06-Jun-2011 02:14 | 27K | |
| Nail Care.jpg | 23-May-2008 22:10 | 17K | |
| Nail Polish Galm Gli..> | 30-Aug-2008 06:27 | 10K | |
| Nail Polish Garnet.jpg | 16-Apr-2009 03:46 | 2.4K | |
| Nail Polish Glam Gli..> | 30-Aug-2008 06:29 | 12K | |
| Nail Polish Glam Gli..> | 20-Apr-2010 03:22 | 41K | |
| Nail Polish Glam Gli..> | 30-Aug-2008 06:30 | 12K | |
| Nail Polish Glam Gli..> | 30-Aug-2008 06:31 | 11K | |
| Nail Polish Glam Gli..> | 20-Apr-2010 03:36 | 41K | |
| Nail Polish Glam Gli..> | 30-Aug-2008 06:32 | 12K | |
| Nail Polish Grape Vi..> | 16-Apr-2009 03:55 | 2.3K | |
| Nail Polish Mauvelou..> | 16-Apr-2009 03:57 | 2.5K | |
| Nail poliah Glam Gli..> | 30-Aug-2008 06:28 | 13K | |
| Natural beige.jpeg | 07-Jun-2011 23:10 | 34K | |
| New Sex in the City ..> | 23-Apr-2010 00:50 | 28K | |
| New Sex in the City ..> | 23-Apr-2010 00:53 | 31K | |
| New Sex in the City ..> | 23-Apr-2010 00:58 | 32K | |
| Normal_starter pack.jpg | 06-Jun-2009 02:14 | 33K | |
| Nturise Chestnut.jpg | 12-Jul-2008 05:07 | 2.6K | |
| Nutrise Cappuccino.jpg | 12-Jul-2008 04:57 | 2.8K | |
| Nutrise Caramel.jpg | 12-Jul-2008 05:01 | 2.9K | |
| Nutrise Honey Dip 7...> | 12-Jul-2008 22:45 | 16K | |
| Nutrise Sangria.jpg | 12-Jul-2008 04:58 | 2.9K | |
| Nutrisse Beechnut 8...> | 14-Jul-2008 03:33 | 2.7K | |
| Nutrisse Praline.jpg | 14-Jul-2008 03:51 | 1.7K | |
| Nutrisse Sandy Blond..> | 14-Jul-2008 03:43 | 3.0K | |
| Nutrisse Vanilla Blo..> | 12-Jul-2008 22:49 | 68K | |
| Obsession edp spray ..> | 23-Apr-2010 00:03 | 27K | |
| Opium edt spray 100m..> | 22-Jun-2008 01:10 | 3.1K | |
| Organza eau de parfu..> | 21-Jun-2008 04:00 | 2.7K | |
| Oscar edt spray 30ml..> | 23-Apr-2010 00:42 | 25K | |
| Oscar edt spray 100m..> | 22-Jun-2008 01:48 | 2.2K | |
| PINK.jpg | 01-Jun-2011 02:36 | 27K | |
| Paco Rabanne edt spr..> | 22-Jun-2008 23:06 | 3.0K | |
| Paris Hilton edp spr..> | 22-Jun-2008 02:04 | 3.2K | |
| Paris edp spray 100m..> | 22-Jun-2008 03:28 | 2.7K | |
| Passion edt spray 44..> | 23-Apr-2010 00:44 | 31K | |
| Passion edt spray 44..> | 22-Jun-2008 04:46 | 2.0K | |
| Pennington Facial_st..> | 06-Jun-2009 01:38 | 30K | |
| Pennington Intensive..> | 06-Jun-2009 02:10 | 19K | |
| Pennington Milk_Clea..> | 06-Jun-2009 01:55 | 20K | |
| Pennington Polish_sc..> | 06-Jun-2009 01:32 | 26K | |
| Pennington SPF_30_Fa..> | 06-Jun-2009 01:53 | 21K | |
| Pennington White_tea..> | 06-Jun-2009 02:39 | 25K | |
| Polo Black edt spray..> | 22-Jun-2008 22:44 | 2.5K | |
| Posse Pouch Pink Lep..> | 09-Aug-2008 03:58 | 58K | |
| Posse pouch black & ..> | 09-Aug-2008 03:59 | 50K | |
| Pufume.jpg | 23-May-2008 22:08 | 27K | |
| Pure Beige Medium 2.jpg | 06-Jun-2011 01:36 | 25K | |
| REVLON SUPER LUSTROU..> | 31-May-2011 01:36 | 25K | |
| ROC HYDRA BIO ACTIVE..> | 22-Apr-2010 10:35 | 29K | |
| Ralph lauren -rocks ..> | 18-May-2010 02:47 | 29K | |
| Red Door edt spray 1..> | 23-Apr-2010 00:47 | 30K | |
| Red giorgio beverly ..> | 18-May-2010 02:33 | 35K | |
| Rev Color.jpg | 18-Sep-2009 06:01 | 1.3K | |
| Revitalift Day Cream..> | 22-Apr-2010 04:46 | 26K | |
| Revitalift Eye Cream..> | 22-Apr-2010 04:47 | 22K | |
| Revitalift Night Cre..> | 22-Apr-2010 04:49 | 25K | |
| Revlon.gif | 23-May-2008 22:17 | 5.4K | |
| Revlon 3 D.jpg | 04-Mar-2009 04:31 | 3.0K | |
| Revlon 3 D Mascara B..> | 21-Apr-2010 03:46 | 21K | |
| Revlon Age Defying D..> | 21-Apr-2010 03:22 | 28K | |
| Revlon Age Defying D..> | 28-Jun-2008 00:24 | 1.4K | |
| Revlon Age Defying N..> | 21-Apr-2010 03:22 | 28K | |
| Revlon Age Defying N..> | 28-Jun-2008 00:44 | 1.0K | |
| Revlon Age Defying S..> | 21-Apr-2010 03:31 | 28K | |
| Revlon Age defying C..> | 21-Apr-2010 03:21 | 24K | |
| Revlon Age defying F..> | 21-Apr-2010 03:48 | 21K | |
| Revlon Beyond Natura..> | 21-Apr-2010 03:50 | 41K | |
| Revlon Brow Fantasy ..> | 06-Jun-2011 01:50 | 29K | |
| Revlon COlor stay AD..> | 29-Nov-2008 03:26 | 183K | |
| Revlon ColorStay Mak..> | 24-Feb-2010 00:56 | 9.6K | |
| Revlon ColorStay Mak..> | 21-Apr-2010 04:03 | 24K | |
| Revlon Colorstay 03 ..> | 21-Apr-2010 04:05 | 28K | |
| Revlon Colorstay Bl..> | 10-Aug-2009 10:56 | 1.4K | |
| Revlon Colorstay Liq..> | 06-Jun-2011 01:57 | 31K | |
| Revlon Colorstay Mak..> | 21-Apr-2010 03:57 | 23K | |
| Revlon Colorstay Mak..> | 21-Apr-2010 03:42 | 26K | |
| Revlon Colorstay Min..> | 21-Apr-2010 02:58 | 26K | |
| Revlon Colorstay Min..> | 21-Apr-2010 04:08 | 27K | |
| Revlon Colorstay Min..> | 28-Apr-2010 01:27 | 25K | |
| Revlon Colorstay Sta..> | 21-Apr-2010 03:42 | 26K | |
| Revlon Colorstay con..> | 27-Jun-2008 23:47 | 964 | |
| Revlon Colorstay mak..> | 28-Jun-2008 01:17 | 1.7K | |
| Revlon Colorstay neu..> | 10-Aug-2009 10:59 | 1.9K | |
| Revlon Colorstay sta..> | 28-Jun-2008 00:00 | 1.4K | |
| Revlon Lash Fantasy.jpg | 17-Jan-2009 04:35 | 2.2K | |
| Revlon Lash Fantasy ..> | 21-Apr-2010 04:14 | 18K | |
| Revlon Loose Shadow ..> | 06-Jun-2009 03:00 | 35K | |
| Revlon Loose Shadow ..> | 06-Jun-2009 02:55 | 33K | |
| Revlon Loose Shadow ..> | 06-Jun-2009 02:58 | 33K | |
| Revlon Love Pat Mois..> | 21-Apr-2010 04:18 | 27K | |
| Revlon Love pat.jpg | 02-Aug-2008 00:08 | 2.3K | |
| Revlon Midnight Garn..> | 10-Aug-2009 10:43 | 12K | |
| Revlon Mineral Found..> | 18-Apr-2009 02:39 | 2.3K | |
| Revlon Nail Enamel F..> | 18-Jul-2008 05:34 | 1.6K | |
| Revlon Naile enamel ..> | 18-Jul-2008 05:32 | 4.1K | |
| Revlon Nail enamel V..> | 18-Jul-2008 05:33 | 1.3K | |
| Revlon Natural Tan c..> | 26-Feb-2009 02:33 | 1.7K | |
| Revlon Photo New Com..> | 06-Jun-2011 02:34 | 28K | |
| Revlon Photo New Com..> | 06-Jun-2011 02:33 | 28K | |
| Revlon Photo New Com..> | 06-Jun-2011 02:35 | 28K | |
| Revlon Photo New Com..> | 06-Jun-2011 02:36 | 28K | |
| Revlon Photo Ready.jpg | 06-May-2010 00:38 | 24K | |
| Revlon Photo Ready P..> | 06-May-2010 00:34 | 27K | |
| Revlon Smoky Quartz.jpg | 10-Aug-2009 10:46 | 2.7K | |
| Revlon Stone wash de..> | 03-Oct-2009 01:59 | 1.2K | |
| Revlon Super Lustro..> | 31-May-2011 00:58 | 24K | |
| Revlon Super Lustro..> | 31-May-2011 01:34 | 24K | |
| Revlon Super Lustrou..> | 25-Jul-2008 01:55 | 6.7K | |
| Revlon Super Lustrou..> | 31-May-2011 01:38 | 23K | |
| Revlon Super Lustrou..> | 25-Jul-2008 03:17 | 11K | |
| Revlon Super Lustrou..> | 25-Jul-2008 03:04 | 11K | |
| Revlon Super lustoru..> | 21-Apr-2010 04:29 | 26K | |
| Revlon Super lustrou..> | 25-Jul-2008 03:08 | 11K | |
| Revlon Superlustrous..> | 31-May-2011 01:40 | 22K | |
| Revlon Superlustrous..> | 31-May-2011 01:41 | 27K | |
| Revlon Superlustrous..> | 31-May-2011 01:42 | 22K | |
| Revlon Superlustrous..> | 31-May-2011 01:43 | 27K | |
| Revlon Superlustrous..> | 31-May-2011 01:01 | 4.4K | |
| Revlon Superlustrous..> | 31-May-2011 01:03 | 22K | |
| Revlon Superlustrous..> | 31-May-2011 01:06 | 25K | |
| Revlon Superlustrous..> | 31-May-2011 01:10 | 24K | |
| Revlon Superlustrous..> | 31-May-2011 01:44 | 27K | |
| Revlon Super lustrou..> | 26-Jul-2008 03:54 | 2.2K | |
| Revlon Super lustrou..> | 25-Jul-2008 03:16 | 11K | |
| Revlon age Defying S..> | 28-Jun-2008 01:27 | 1.7K | |
| Revlon age defying c..> | 30-Oct-2008 09:12 | 1.7K | |
| Revlon age defying f..> | 04-Sep-2009 04:34 | 1.1K | |
| Revlon colorstay Ste..> | 03-Oct-2009 02:01 | 1.5K | |
| Revlon colorstay eye..> | 10-Aug-2009 11:02 | 2.4K | |
| Revlon colorstay mak..> | 28-Jun-2008 01:05 | 1.7K | |
| Revlon super Lustrou..> | 31-May-2011 01:35 | 26K | |
| Revlon super Lustrou..> | 25-Jul-2008 03:14 | 11K | |
| Rimmel 001 black.jpg | 06-Jun-2011 02:49 | 25K | |
| Rimmel Black.jpg | 06-Jun-2011 02:50 | 27K | |
| Roc Hydra BIO ACTIVE..> | 15-Apr-2010 02:12 | 137K | |
| Roc Hydra BIO ACTIVE..> | 15-Apr-2010 02:13 | 100K | |
| Roc Hydra BIO ACTIVE..> | 15-Apr-2010 02:14 | 107K | |
| SAMSARA edt 50 ml.jpg | 27-Apr-2010 01:59 | 33K | |
| SEx in the city Kiss..> | 20-Sep-2008 04:43 | 2.0K | |
| Sally Hansen Air Bru..> | 18-Sep-2008 06:10 | 3.5K | |
| Sally Hansen Diamond..> | 28-Jun-2008 03:39 | 3.2K | |
| Sally Hansen French ..> | 28-Jun-2008 03:59 | 1.5K | |
| Sally Hansen Super S..> | 28-Jun-2008 03:45 | 1.5K | |
| Samsara edp spray 10..> | 22-Jun-2008 04:01 | 3.2K | |
| Sandy Beige Medium 1..> | 06-Jun-2011 01:33 | 25K | |
| Sex in the City Love..> | 23-Apr-2010 00:55 | 31K | |
| Sex in the city Love..> | 20-Sep-2008 04:40 | 2.4K | |
| Shalimar edt spray 5..> | 27-Apr-2010 01:37 | 24K | |
| Shiny Licious passio..> | 08-Sep-2009 10:21 | 4.0K | |
| Silicone Bras.jpg | 23-May-2008 22:10 | 13K | |
| Skincare.jpg | 23-May-2008 22:08 | 28K | |
| Still edp spray 100m..> | 27-Apr-2010 01:39 | 21K | |
| Sunflowers edt spray..> | 27-Apr-2010 01:41 | 32K | |
| Tanning.jpg | 23-May-2008 22:08 | 36K | |
| True Match alabaster..> | 20-Apr-2010 11:10 | 94K | |
| True Match alabaster..> | 20-Apr-2010 11:12 | 25K | |
| True Match alabaster..> | 25-Jun-2008 04:10 | 1.8K | |
| True Match classic b..> | 25-Jun-2008 04:12 | 1.8K | |
| True Match natural b..> | 25-Jun-2008 04:19 | 1.1K | |
| True Match nude beig..> | 25-Jun-2008 04:15 | 1.0K | |
| True Star edt spray ..> | 22-Jun-2008 22:23 | 2.0K | |
| Versace Blue Jeans e..> | 22-Jun-2008 22:55 | 3.4K | |
| Versace Profumi edt ..> | 22-Jun-2008 22:51 | 1.5K | |
| Versace Women edp sp..> | 22-Jun-2008 03:51 | 1.7K | |
| Very Sexy Now 75ml.jpg | 04-Mar-2009 04:09 | 1.3K | |
| White Diamonds 100ml..> | 27-Apr-2010 01:44 | 30K | |
| Withlove Hilary Duff..> | 27-Apr-2010 01:46 | 36K | |
| Withlove Hilary Duff..> | 22-Jun-2008 01:49 | 1.6K | |
| Xeryus Rouge edt Spr..> | 22-Jun-2008 05:23 | 3.6K | |
| YSL RIVE gauche 100m..> | 27-Apr-2010 02:14 | 37K | |
| YVRESSE EDT 125ML.jpg | 27-Apr-2010 02:02 | 28K | |
| Ysatis edt spray 50m..> | 27-Apr-2010 01:47 | 35K | |
| _Mascara Black Glitter_ | 30-Aug-2008 06:41 | 8.0K | |
| account_notification..> | 18-Jun-2008 07:24 | 1.7K | |
| account_orders.gif | 18-Jun-2008 07:24 | 2.3K | |
| account_personal.gif | 18-Jun-2008 07:24 | 2.5K | |
| age perfect day crea..> | 17-Jun-2008 06:09 | 14K | |
| age perfect eye crea..> | 17-Jun-2008 06:29 | 4.4K | |
| age perfect night cr..> | 17-Jun-2008 06:26 | 7.5K | |
| age reperfect day.jpg | 17-Jun-2008 06:48 | 23K | |
| age re perfect found..> | 15-Sep-2008 06:22 | 2.4K | |
| age re perfect lip c..> | 12-Oct-2008 02:46 | 10K | |
| age re perfect night..> | 17-Jun-2008 07:31 | 22K | |
| almay.jpg | 06-Jun-2011 03:12 | 19K | |
| aramis.jpg | 05-Feb-2009 23:43 | 39K | |
| arrow_down.gif | 18-Jun-2008 07:22 | 386 | |
| arrow_east_south.gif | 18-Jun-2008 07:22 | 433 | |
| arrow_green.gif | 18-Jun-2008 07:22 | 69 | |
| arrow_south_east.gif | 18-Jun-2008 07:22 | 434 | |
| banners/ | 14-May-2008 16:09 | - | |
| beautiful 30ml edp.jpg | 27-Apr-2010 02:25 | 30K | |
| bg.gif | 11-Jun-2008 01:27 | 357 | |
| bg_box.gif | 11-Jun-2008 01:26 | 43 | |
| bot.gif | 11-Jun-2008 01:26 | 132 | |
| box_products_notific..> | 22-May-2008 16:35 | 1.4K | |
| box_products_notific..> | 22-May-2008 16:35 | 1.5K | |
| box_write_review.gif | 22-May-2008 16:35 | 1.0K | |
| buff.jpeg | 07-Jun-2011 23:08 | 33K | |
| business.jpg | 22-May-2008 16:36 | 8.3K | |
| button_add_to_cart1.gif | 21-May-2008 02:50 | 243 | |
| button_details.gif | 21-May-2008 02:50 | 207 | |
| cai_ba6xr6.jpg | 22-May-2008 16:36 | 4.3K | |
| cai_babossv8.jpg | 22-May-2008 16:36 | 4.3K | |
| cashmere.jpg | 05-Feb-2009 23:49 | 28K | |
| category_hardware.gif | 22-May-2008 16:36 | 1.7K | |
| checkout_bullet.gif | 22-May-2008 16:36 | 533 | |
| ckin2u her 150ml.jpg | 18-May-2010 02:37 | 32K | |
| col_perf.gif | 11-Mar-2009 08:43 | 13K | |
| cool ivory.jpeg | 07-Jun-2011 23:05 | 33K | |
| copyright.gif | 04-May-2008 01:12 | 717 | |
| covergirl_fantasicla..> | 12-Jul-2008 03:41 | 19K | |
| default/ | 14-May-2008 16:09 | - | |
| derma Genesis eye cr..> | 15-Nov-2008 02:52 | 2.4K | |
| deseo edp 100ml.jpg | 18-May-2010 02:45 | 33K | |
| dvd/ | 14-May-2008 16:09 | - | |
| elizabethArden.jpg | 23-May-2008 22:15 | 3.0K | |
| evogroup.jpg | 22-May-2008 16:38 | 56K | |
| f6_11.jpg | 22-May-2008 16:38 | 8.9K | |
| face_foundation_8.jpeg | 06-Jun-2011 03:15 | 26K | |
| fg-gbcv-bt.jpg | 22-May-2008 16:38 | 20K | |
| fg-gbcv-ds.jpg | 22-May-2008 16:38 | 29K | |
| fg-gbcv-ss.jpg | 22-May-2008 16:39 | 26K | |
| fourms.jpg | 22-May-2008 16:39 | 6.7K | |
| garnier.jpg | 23-May-2008 22:17 | 6.9K | |
| glitter-blue-colour-..> | 01-Jun-2011 02:27 | 41K | |
| glitter purples.jpg | 01-Jun-2011 02:38 | 28K | |
| gt_interactive/ | 14-May-2008 16:09 | - | |
| header_account.gif | 22-May-2008 16:40 | 439 | |
| header_cart.gif | 22-May-2008 16:40 | 535 | |
| header_checkout.gif | 22-May-2008 16:40 | 605 | |
| hewlett_packard/ | 14-May-2008 16:09 | - | |
| hks.jpg | 22-May-2008 16:40 | 4.1K | |
| icon(1).gif | 21-May-2008 02:50 | 113 | |
| icon(2).gif | 21-May-2008 02:50 | 128 | |
| icons/ | 14-May-2008 16:10 | - | |
| img-thing.jpeg | 01-Jun-2011 02:19 | 7.6K | |
| infobox/ | 14-May-2008 16:10 | - | |
| intense black.jpeg | 07-Jun-2011 23:16 | 28K | |
| joico.gif | 23-May-2008 22:12 | 1.5K | |
| joop.jpg | 17-Jun-2008 10:01 | 2.7K | |
| kn.jpg | 22-May-2008 16:40 | 1.6K | |
| knowing 30 ml edp.jpg | 27-Apr-2010 02:17 | 27K | |
| launch.jpg | 22-May-2008 16:40 | 63K | |
| login.gif | 04-May-2008 01:12 | 563 | |
| logo.gif | 04-May-2008 01:12 | 1.2K | |
| logo.jpg | 22-May-2008 16:40 | 6.3K | |
| logo1.jpg | 23-May-2008 17:47 | 14K | |
| loreal Men expert 50..> | 15-Nov-2008 03:13 | 1.8K | |
| loreal Wear Infinite..> | 09-Aug-2008 03:51 | 19K | |
| lrl colour appeal Sa..> | 09-Aug-2008 02:17 | 30K | |
| lupa.gif | 04-May-2008 01:12 | 296 | |
| m02.gif | 22-May-2008 16:41 | 1.5K | |
| m03.gif | 22-May-2008 16:41 | 1.7K | |
| m04.gif | 22-May-2008 16:41 | 1.5K | |
| m05.gif | 22-May-2008 16:41 | 1.6K | |
| m06.gif | 22-May-2008 16:41 | 1.5K | |
| m07.gif | 22-May-2008 16:41 | 294 | |
| m07.jpg | 22-May-2008 16:41 | 15K | |
| m08.gif | 22-May-2008 16:41 | 58 | |
| m08.jpg | 22-May-2008 16:41 | 28K | |
| m09.gif | 22-May-2008 16:41 | 44 | |
| m09.jpg | 22-May-2008 16:41 | 21K | |
| m1.gif | 11-Jun-2008 02:18 | 836 | |
| m2.gif | 11-Jun-2008 02:18 | 703 | |
| m3.gif | 11-Jun-2008 02:18 | 596 | |
| m4.gif | 11-Jun-2008 02:18 | 642 | |
| m5.gif | 11-Jun-2008 02:18 | 682 | |
| m10.gif | 22-May-2008 16:41 | 336 | |
| m10.jpg | 22-May-2008 16:41 | 81K | |
| m11.gif | 22-May-2008 16:41 | 280 | |
| m11.jpg | 22-May-2008 16:41 | 81K | |
| m12.gif | 22-May-2008 16:41 | 220 | |
| m13.gif | 22-May-2008 16:42 | 49 | |
| m14.gif | 22-May-2008 16:42 | 1.3K | |
| m14.jpg | 22-May-2008 16:42 | 12K | |
| m15.gif | 22-May-2008 16:42 | 49 | |
| m16.gif | 22-May-2008 16:42 | 237 | |
| m16.jpg | 22-May-2008 16:42 | 5.7K | |
| m17.gif | 22-May-2008 16:42 | 217 | |
| m19.gif | 22-May-2008 16:42 | 213 | |
| m19.jpg | 22-May-2008 16:42 | 9.9K | |
| m20.gif | 23-May-2008 15:40 | 54 | |
| m20.jpg | 23-May-2008 15:41 | 21K | |
| m21.gif | 22-May-2008 16:42 | 236 | |
| m21.jpg | 22-May-2008 16:42 | 7.3K | |
| m22.gif | 22-May-2008 16:42 | 1.7K | |
| m22.jpg | 22-May-2008 16:42 | 20K | |
| m23.gif | 22-May-2008 16:42 | 2.7K | |
| m23.jpg | 22-May-2008 16:42 | 21K | |
| m24.gif | 22-May-2008 16:42 | 4.2K | |
| m24.jpg | 22-May-2008 16:42 | 4.1K | |
| m25.jpg | 22-May-2008 16:42 | 2.7K | |
| m26.jpg | 22-May-2008 16:42 | 3.4K | |
| m27.gif | 22-May-2008 16:42 | 849 | |
| m28.gif | 22-May-2008 16:42 | 161 | |
| m29.gif | 22-May-2008 16:42 | 161 | |
| m30.gif | 22-May-2008 16:42 | 331 | |
| m31.gif | 22-May-2008 16:42 | 46 | |
| m32.gif | 22-May-2008 16:42 | 397 | |
| m33.gif | 22-May-2008 16:42 | 2.4K | |
| m34.gif | 22-May-2008 16:42 | 2.2K | |
| m35.gif | 22-May-2008 16:42 | 319 | |
| m36.gif | 22-May-2008 16:43 | 1.6K | |
| m37.gif | 22-May-2008 16:43 | 200 | |
| m99.gif | 22-May-2008 16:43 | 46 | |
| m109.gif | 22-May-2008 16:41 | 1.2K | |
| mail/ | 14-May-2008 16:10 | - | |
| manufacturer_canon.gif | 22-May-2008 16:43 | 1.1K | |
| manufacturer_fox.gif | 22-May-2008 16:43 | 2.5K | |
| manufacturer_gt_inte..> | 22-May-2008 16:43 | 1.4K | |
| manufacturer_hewlett..> | 22-May-2008 16:43 | 640 | |
| manufacturer_logitec..> | 22-May-2008 16:43 | 1.0K | |
| manufacturer_matrox.gif | 22-May-2008 16:43 | 904 | |
| manufacturer_microso..> | 22-May-2008 16:43 | 667 | |
| manufacturer_sierra.gif | 22-May-2008 16:43 | 1.1K | |
| manufacturer_warner.gif | 22-May-2008 16:43 | 2.1K | |
| matrox/ | 14-May-2008 16:10 | - | |
| max-factor-colour-pe..> | 11-Mar-2009 09:12 | 13K | |
| maxFactor.jpg | 23-May-2008 22:15 | 8.2K | |
| maybelline_makeup-3i..> | 21-Apr-2010 02:01 | 9.8K | |
| mechanics.jpg | 22-May-2008 16:43 | 7.3K | |
| microsoft/ | 14-May-2008 16:10 | - | |
| miracle edp 100ml .jpg | 27-Apr-2010 02:38 | 24K | |
| miss dior christian ..> | 27-Apr-2010 02:10 | 28K | |
| n33.gif | 22-May-2008 16:43 | 29K | |
| nyx.gif | 23-May-2008 22:16 | 2.2K | |
| oldoscommerce.gif | 22-May-2008 16:45 | 3.6K | |
| old spice aftershave..> | 17-Oct-2008 08:01 | 2.7K | |
| oreal Derma Genesis ..> | 22-Apr-2010 04:38 | 22K | |
| oscommerce.gif | 22-May-2008 16:45 | 6.8K | |
| outlast_always_rosy.jpg | 03-Jul-2009 05:04 | 5.9K | |
| outlast_brazenRaisin..> | 03-Jul-2009 04:49 | 7.2K | |
| outlast_eternal_flam..> | 03-Jul-2009 04:58 | 7.7K | |
| outlast_forever_fawn..> | 03-Jul-2009 05:23 | 6.2K | |
| outlast_lingering.jpg | 03-Jul-2009 05:20 | 7.3K | |
| outlast_timeless.jpg | 03-Jul-2009 05:25 | 7.1K | |
| p1.gif | 09-Jun-2008 03:35 | 3.1K | |
| p1old.gif | 21-May-2008 02:50 | 3.3K | |
| picher.jpg | 04-May-2008 01:12 | 16K | |
| pipe1.jpg | 22-May-2008 16:45 | 13K | |
| pixel_black.gif | 22-May-2008 16:45 | 35 | |
| pixel_silver.gif | 22-May-2008 16:45 | 35 | |
| pixel_trans.gif | 22-May-2008 16:45 | 43 | |
| podspanels.jpg | 22-May-2008 16:45 | 4.3K | |
| podspanelsm.jpg | 22-May-2008 16:45 | 1.2K | |
| prelude.jpg | 22-May-2008 16:45 | 32K | |
| q1.gif | 21-May-2008 02:51 | 194 | |
| q2.gif | 21-May-2008 02:51 | 192 | |
| q3.gif | 21-May-2008 02:51 | 138 | |
| q4.gif | 21-May-2008 02:51 | 196 | |
| radio.jpg | 22-May-2008 16:45 | 9.0K | |
| red door.jpg | 17-Jun-2008 09:58 | 2.4K | |
| relon powder 2.jpg | 05-Feb-2009 23:33 | 37K | |
| rev 523.jpg | 29-May-2011 02:30 | 4.6K | |
| rev coffee break 133..> | 29-May-2011 02:25 | 4.1K | |
| revitalift day cream..> | 17-Jun-2008 05:58 | 38K | |
| revitalift eye cream..> | 17-Jun-2008 06:03 | 42K | |
| revitalift night cre..> | 17-Jun-2008 06:01 | 13K | |
| revitalift pic.jpg | 17-Jun-2008 07:34 | 43K | |
| revlon-colorstay fou..> | 12-Jul-2008 04:21 | 13K | |
| revlon 470 sl.bmp | 29-May-2011 02:26 | 32K | |
| revlon lash 1.jpg | 05-Feb-2009 23:35 | 24K | |
| revlon super lustrou..> | 26-Jul-2008 04:29 | 1.6K | |
| sallyhansen.jpg | 23-May-2008 22:13 | 5.0K | |
| sally hansen age cor..> | 28-Jun-2008 03:36 | 2.3K | |
| sally hansen cuticle..> | 28-Jun-2008 03:43 | 1.2K | |
| sally hansen hard as..> | 28-Jun-2008 03:52 | 2.3K | |
| sally hansen triple ..> | 28-Jun-2008 03:54 | 1.6K | |
| sand beige.jpeg | 07-Jun-2011 23:06 | 33K | |
| sex city yellow.jpg | 26-Sep-2008 03:55 | 50K | |
| sex in city red copy..> | 26-Sep-2008 03:58 | 43K | |
| sierra/ | 14-May-2008 16:10 | - | |
| skin_33.jpg | 21-May-2008 02:51 | 5.8K | |
| skin_34.jpg | 21-May-2008 02:51 | 7.2K | |
| skin_35.jpg | 21-May-2008 02:51 | 9.6K | |
| skin_36.jpg | 21-May-2008 02:51 | 3.9K | |
| spacer.gif | 21-May-2008 02:51 | 43 | |
| speco.png | 22-May-2008 16:46 | 33K | |
| speedmeters.jpg | 22-May-2008 16:47 | 8.0K | |
| speedmetersm.jpg | 22-May-2008 16:47 | 1.5K | |
| stars_1.gif | 22-May-2008 16:47 | 145 | |
| stars_2.gif | 22-May-2008 16:47 | 151 | |
| stars_3.gif | 22-May-2008 16:47 | 147 | |
| stars_4.gif | 22-May-2008 16:47 | 145 | |
| stars_5.gif | 22-May-2008 16:47 | 127 | |
| stylesheet.css | 21-May-2008 02:51 | 17K | |
| subcategory.gif | 22-May-2008 16:47 | 308 | |
| subcategory_cdrom_dr..> | 22-May-2008 16:47 | 1.6K | |
| subcategory_graphic_..> | 22-May-2008 16:47 | 2.0K | |
| subcategory_keyboard..> | 22-May-2008 16:47 | 1.2K | |
| subcategory_memory.gif | 22-May-2008 16:47 | 2.4K | |
| subcategory_mice.gif | 22-May-2008 16:47 | 1.1K | |
| subcategory_monitors..> | 22-May-2008 16:47 | 1.4K | |
| subcategory_printers..> | 22-May-2008 16:47 | 1.1K | |
| sunflowers.jpg | 17-Jun-2008 10:04 | 1.9K | |
| table_background_acc..> | 22-May-2008 16:47 | 1.0K | |
| table_background_add..> | 22-May-2008 16:47 | 1.5K | |
| table_background_bro..> | 22-May-2008 16:47 | 1.2K | |
| table_background_car..> | 22-May-2008 16:47 | 1.4K | |
| table_background_che..> | 22-May-2008 16:47 | 1.4K | |
| table_background_con..> | 22-May-2008 16:48 | 1.2K | |
| table_background_con..> | 22-May-2008 16:48 | 788 | |
| table_background_def..> | 22-May-2008 16:48 | 877 | |
| table_background_del..> | 22-May-2008 16:48 | 847 | |
| table_background_his..> | 22-May-2008 16:48 | 1.2K | |
| table_background_log..> | 22-May-2008 16:48 | 1.3K | |
| table_background_man..> | 22-May-2008 16:48 | 4.2K | |
| table_background_pas..> | 22-May-2008 16:48 | 1.3K | |
| table_background_pay..> | 22-May-2008 16:48 | 1.1K | |
| table_background_pro..> | 22-May-2008 16:48 | 688 | |
| table_background_rev..> | 22-May-2008 16:48 | 1.1K | |
| table_background_rev..> | 22-May-2008 16:48 | 1.6K | |
| table_background_spe..> | 22-May-2008 16:48 | 1.1K | |
| tachos.jpg | 22-May-2008 16:48 | 21K | |
| tachosm.jpg | 22-May-2008 16:48 | 1.2K | |
| tigi.jpg | 23-May-2008 22:12 | 17K | |
| tile.gif | 04-May-2008 01:12 | 45 | |
| tile1.gif | 04-May-2008 01:12 | 45 | |
| tile2.gif | 04-May-2008 01:12 | 46 | |
| tile3.gif | 04-May-2008 01:12 | 45 | |
| top.jpg | 11-Jun-2008 01:35 | 62K | |
| turbosmart.jpg | 22-May-2008 16:48 | 2.0K | |
| vnvsv6.jpg | 22-May-2008 16:49 | 26K | |
| vnvsv8.jpg | 22-May-2008 16:49 | 31K | |
| volupte 100ml edt | 18-May-2010 02:26 | 26K | |
| volupte 100ml edt.jpg | 18-May-2010 02:28 | 26K | |
| vtvxv6.jpg | 22-May-2008 16:49 | 31K | |
| vtvxv8.jpg | 22-May-2008 16:49 | 35K | |
| vyv6.jpg | 22-May-2008 16:49 | 31K | |
| vyv8.jpg | 22-May-2008 16:49 | 34K | |
| vzGrowler2.jpg | 22-May-2008 16:49 | 5.9K | |
| vzv6v8.jpg | 22-May-2008 16:49 | 30K | |
| white diamonds.jpg | 05-Feb-2009 23:38 | 38K | |
| whiteline.jpg | 22-May-2008 16:49 | 2.5K | |
| white linen edp 30ml..> | 27-Apr-2010 02:30 | 32K | |
| wonder Finish Founda..> | 12-Oct-2008 02:36 | 2.5K | |
| z.gif | 11-Jun-2008 01:26 | 46 | |
| z1.gif | 11-Jun-2008 01:27 | 154 | |
| z4.gif | 11-Jun-2008 01:27 | 49 | |
